C23H34N2O7 — CID 59455623
benzyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-hydroxypiperidine-1-carboxylate (PubChem CID 59455623) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is benzyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | benzyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 59455623 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | benzyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1CN(C(=O)OCc2ccccc2)CCC1O |
| InChI | InChI=1S/C23H34N2O7/c1-22(2,3)31-20(28)25(21(29)32-23(4,5)6)17-14-24(13-12-18(17)26)19(27)30-15-16-10-8-7-9-11-16/h7-11,17-18,26H,12-15H2,1-6H3 |
| InChIKey | JHCICODCWYHUAI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|