C25H33N3O4 — CID 155090457
benzyl 4-[(2-aminophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidine-1-carboxylate (PubChem CID 155090457) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is benzyl 4-[(2-aminophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(2-aminophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155090457 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | benzyl 4-[(2-aminophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1N)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H33N3O4/c1-25(2,3)32-24(30)28(17-20-11-7-8-12-22(20)26)21-13-15-27(16-14-21)23(29)31-18-19-9-5-4-6-10-19/h4-12,21H,13-18,26H2,1-3H3 |
| InChIKey | KHCJBTVBJYERLH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|