C23H23NO7 — CID 23254706
[(1S,4S,5S,7S)-7-[benzyl(phenylmethoxycarbonyl)amino]-3-oxo-2,8-dioxabicyclo[3.2.1]octan-4-yl] acetate (PubChem CID 23254706) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is [(1S,4S,5S,7S)-7-[benzyl(phenylmethoxycarbonyl)amino]-3-oxo-2,8-dioxabicyclo[3.2.1]octan-4-yl] acetate.
| Compound Name | [(1S,4S,5S,7S)-7-[benzyl(phenylmethoxycarbonyl)amino]-3-oxo-2,8-dioxabicyclo[3.2.1]octan-4-yl] acetate |
|---|---|
| PubChem CID | 23254706 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [(1S,4S,5S,7S)-7-[benzyl(phenylmethoxycarbonyl)amino]-3-oxo-2,8-dioxabicyclo[3.2.1]octan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)O[C@@H]2O[C@H]1C[C@@H]2N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H23NO7/c1-15(25)29-20-19-12-18(22(30-19)31-21(20)26)24(13-16-8-4-2-5-9-16)23(27)28-14-17-10-6-3-7-11-17/h2-11,18-20,22H,12-14H2,1H3/t18-,19-,20-,22-/m0/s1 |
| InChIKey | HYJYSDNVXQZGDO-XWUOBKMESA-N |
| XLogP | 2.80 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|