C37H45N3O8 — CID 154734785
propan-2-yl (1R,3S,4R,5R)-3-azido-5-hydroxy-4-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexane-1-carboxylate (PubChem CID 154734785) has the molecular formula C37H45N3O8 and a molecular weight of 659.78 g/mol. Its IUPAC name is propan-2-yl (1R,3S,4R,5R)-3-azido-5-hydroxy-4-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexane-1-carboxylate.
| Compound Name | propan-2-yl (1R,3S,4R,5R)-3-azido-5-hydroxy-4-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 154734785 |
| Molecular Formula | C37H45N3O8 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | propan-2-yl (1R,3S,4R,5R)-3-azido-5-hydroxy-4-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexane-1-carboxylate |
| SMILES | CC(C)OC(=O)[C@H]1C[C@@H](O)[C@H](O[C@@H]2O[C@@H](C)[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C37H45N3O8/c1-24(2)46-36(42)29-19-30(39-40-38)33(31(41)20-29)48-37-35(45-23-28-17-11-6-12-18-28)34(44-22-27-15-9-5-10-16-27)32(25(3)47-37)43-21-26-13-7-4-8-14-26/h4-18,24-25,29-35,37,41H,19-23H2,1-3H3/t25-,29+,30-,31+,32+,33+,34+,35-,37-/m0/s1 |
| InChIKey | ITZUPMPDMLWEOL-JQGDKEAOSA-N |
| XLogP | 6.27 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|