C36H44O6 — CID 67245722
(1R,2R,3R)-3-cyclopropyl-2-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexan-1-ol (PubChem CID 67245722) has the molecular formula C36H44O6 and a molecular weight of 572.74 g/mol. Its IUPAC name is (1R,2R,3R)-3-cyclopropyl-2-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexan-1-ol.
| Compound Name | (1R,2R,3R)-3-cyclopropyl-2-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexan-1-ol |
|---|---|
| PubChem CID | 67245722 |
| Molecular Formula | C36H44O6 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | (1R,2R,3R)-3-cyclopropyl-2-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexan-1-ol |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@H](O)CCC[C@@H]2C2CC2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H44O6/c1-25-32(38-22-26-12-5-2-6-13-26)34(39-23-27-14-7-3-8-15-27)35(40-24-28-16-9-4-10-17-28)36(41-25)42-33-30(29-20-21-29)18-11-19-31(33)37/h2-10,12-17,25,29-37H,11,18-24H2,1H3/t25-,30+,31+,32+,33+,34+,35-,36-/m0/s1 |
| InChIKey | YLCQGOGQVZWQEY-YOOJUZHJSA-N |
| XLogP | 6.44 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |