C19H26O5 — CID 129196193
1-O-benzyl 2-O-(3-hydroxybutan-2-yl) cyclohexane-1,2-dicarboxylate (PubChem CID 129196193) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 1-O-benzyl 2-O-(3-hydroxybutan-2-yl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-(3-hydroxybutan-2-yl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 129196193 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-O-benzyl 2-O-(3-hydroxybutan-2-yl) cyclohexane-1,2-dicarboxylate |
| SMILES | CC(O)C(C)OC(=O)C1CCCCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26O5/c1-13(20)14(2)24-19(22)17-11-7-6-10-16(17)18(21)23-12-15-8-4-3-5-9-15/h3-5,8-9,13-14,16-17,20H,6-7,10-12H2,1-2H3 |
| InChIKey | RCHFGLKZUUIXHW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |