C27H40O7 — CID 118100484
1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2-O-(2-methyl-1-phenylmethoxypropyl) cyclohexane-1,2-dicarboxylate (PubChem CID 118100484) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2-O-(2-methyl-1-phenylmethoxypropyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2-O-(2-methyl-1-phenylmethoxypropyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118100484 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2-O-(2-methyl-1-phenylmethoxypropyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C1CCCCC1C(=O)OC(OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C27H40O7/c1-6-27(4,5)26(30)32-17-16-31-23(28)21-14-10-11-15-22(21)24(29)34-25(19(2)3)33-18-20-12-8-7-9-13-20/h7-9,12-13,19,21-22,25H,6,10-11,14-18H2,1-5H3 |
| InChIKey | YBMYXAHVMLVJAY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|