C26H40O4 — CID 90764767
2-O-benzyl 1-O-tert-butyl (2R)-cyclopentane-1,2-dicarboxylate;4,4-dimethylhex-1-ene (PubChem CID 90764767) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2R)-cyclopentane-1,2-dicarboxylate;4,4-dimethylhex-1-ene.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2R)-cyclopentane-1,2-dicarboxylate;4,4-dimethylhex-1-ene |
|---|---|
| PubChem CID | 90764767 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2R)-cyclopentane-1,2-dicarboxylate;4,4-dimethylhex-1-ene |
| SMILES | C=CCC(C)(C)CC.CC(C)(C)OC(=O)C1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H24O4.C8H16/c1-18(2,3)22-17(20)15-11-7-10-14(15)16(19)21-12-13-8-5-4-6-9-13;1-5-7-8(3,4)6-2/h4-6,8-9,14-15H,7,10-12H2,1-3H3;5H,1,6-7H2,2-4H3/t14-,15?;/m1./s1 |
| InChIKey | IVOAQMLMFVQJFG-FUISWZMFSA-N |
| XLogP | 6.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|