C21H24N4O4 — CID 170200341
[[(1R)-1-[(2S)-5-azido-6-hydroxyoxan-2-yl]ethyl]-benzylamino] benzoate (PubChem CID 170200341) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is [[(1R)-1-[(2S)-5-azido-6-hydroxyoxan-2-yl]ethyl]-benzylamino] benzoate.
| Compound Name | [[(1R)-1-[(2S)-5-azido-6-hydroxyoxan-2-yl]ethyl]-benzylamino] benzoate |
|---|---|
| PubChem CID | 170200341 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [[(1R)-1-[(2S)-5-azido-6-hydroxyoxan-2-yl]ethyl]-benzylamino] benzoate |
| SMILES | C[C@H]([C@@H]1CCC(N=[N+]=[N-])C(O)O1)N(Cc1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N4O4/c1-15(19-13-12-18(23-24-22)21(27)28-19)25(14-16-8-4-2-5-9-16)29-20(26)17-10-6-3-7-11-17/h2-11,15,18-19,21,27H,12-14H2,1H3/t15-,18?,19+,21?/m1/s1 |
| InChIKey | KFTWQHWFGPHQBL-PJABQADQSA-N |
| XLogP | 3.83 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|