C15H17N3O4 — CID 90984151
[(1R,2S,5S)-2-azido-5-methoxycarbonylcyclohexyl] benzoate (PubChem CID 90984151) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is [(1R,2S,5S)-2-azido-5-methoxycarbonylcyclohexyl] benzoate.
| Compound Name | [(1R,2S,5S)-2-azido-5-methoxycarbonylcyclohexyl] benzoate |
|---|---|
| PubChem CID | 90984151 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [(1R,2S,5S)-2-azido-5-methoxycarbonylcyclohexyl] benzoate |
| SMILES | COC(=O)[C@H]1CC[C@H](N=[N+]=[N-])[C@H](OC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H17N3O4/c1-21-14(19)11-7-8-12(17-18-16)13(9-11)22-15(20)10-5-3-2-4-6-10/h2-6,11-13H,7-9H2,1H3/t11-,12-,13+/m0/s1 |
| InChIKey | IWNJPYXNGXPKQX-RWMBFGLXSA-N |
| XLogP | 2.86 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|