C22H22N4O4 — CID 101465935
[(1S,2S,7S,8aS)-7-azido-1-benzoyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] benzoate (PubChem CID 101465935) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is [(1S,2S,7S,8aS)-7-azido-1-benzoyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] benzoate.
| Compound Name | [(1S,2S,7S,8aS)-7-azido-1-benzoyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] benzoate |
|---|---|
| PubChem CID | 101465935 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [(1S,2S,7S,8aS)-7-azido-1-benzoyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@H]1CCN2C[C@H](OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C22H22N4O4/c23-25-24-17-11-12-26-14-19(29-21(27)15-7-3-1-4-8-15)20(18(26)13-17)30-22(28)16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-,19-,20-/m0/s1 |
| InChIKey | RZEKHSJVXVZPMR-MUGJNUQGSA-N |
| XLogP | 3.59 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|