C14H15NO4 — CID 10825295
[(1R,6R,8S)-6-hydroxy-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-1-yl] benzoate (PubChem CID 10825295) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is [(1R,6R,8S)-6-hydroxy-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-1-yl] benzoate.
| Compound Name | [(1R,6R,8S)-6-hydroxy-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-1-yl] benzoate |
|---|---|
| PubChem CID | 10825295 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | [(1R,6R,8S)-6-hydroxy-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-1-yl] benzoate |
| SMILES | O=C(O[C@@H]1CCN2C(=O)[C@H](O)C[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C14H15NO4/c16-11-8-10-12(6-7-15(10)13(11)17)19-14(18)9-4-2-1-3-5-9/h1-5,10-12,16H,6-8H2/t10-,11+,12+/m0/s1 |
| InChIKey | LCRYNVAXDDRJIL-QJPTWQEYSA-N |
| XLogP | 0.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |