C24H29NO2 — CID 40555068
[(1R,2S)-2-(4-phenylpiperidin-1-yl)cyclohexyl] benzoate (PubChem CID 40555068) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is [(1R,2S)-2-(4-phenylpiperidin-1-yl)cyclohexyl] benzoate.
| Compound Name | [(1R,2S)-2-(4-phenylpiperidin-1-yl)cyclohexyl] benzoate |
|---|---|
| PubChem CID | 40555068 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | [(1R,2S)-2-(4-phenylpiperidin-1-yl)cyclohexyl] benzoate |
| SMILES | O=C(O[C@@H]1CCCC[C@@H]1N1CCC(c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c26-24(21-11-5-2-6-12-21)27-23-14-8-7-13-22(23)25-17-15-20(16-18-25)19-9-3-1-4-10-19/h1-6,9-12,20,22-23H,7-8,13-18H2/t22-,23+/m0/s1 |
| InChIKey | FFBGIFBVWIAEIA-XZOQPEGZSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |