C17H21NO4 — CID 54559878
methyl 3-benzoyloxy-8-(deuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 54559878) has the molecular formula C17H21NO4 and a molecular weight of 304.36 g/mol. Its IUPAC name is methyl 3-benzoyloxy-8-(deuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-benzoyloxy-8-(deuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 54559878 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl 3-benzoyloxy-8-(deuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | [2H]CN1C2CCC1C(C(=O)OC)C(OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C17H21NO4/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11/h3-7,12-15H,8-10H2,1-2H3/i1D |
| InChIKey | ZPUCINDJVBIVPJ-MICDWDOJSA-N |
| XLogP | 1.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |