C17H23NO8S — CID 67574114
methyl 3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;sulfuric acid (PubChem CID 67574114) has the molecular formula C17H23NO8S and a molecular weight of 401.44 g/mol. Its IUPAC name is methyl 3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;sulfuric acid.
| Compound Name | methyl 3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;sulfuric acid |
|---|---|
| PubChem CID | 67574114 |
| Molecular Formula | C17H23NO8S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | methyl 3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;sulfuric acid |
| SMILES | COC(=O)C1C(OC(=O)c2ccccc2)CC2CCC1N2C.O=S(=O)(O)O |
| InChI | InChI=1S/C17H21NO4.H2O4S/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11;1-5(2,3)4/h3-7,12-15H,8-10H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | OHOXZHVORBDIEV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|