C17H19N3O7S — CID 42599437
[(1R,5S,6R)-5-azido-3-ethoxycarbonyl-6-methylsulfonyloxycyclohex-3-en-1-yl] benzoate (PubChem CID 42599437) has the molecular formula C17H19N3O7S and a molecular weight of 409.42 g/mol. Its IUPAC name is [(1R,5S,6R)-5-azido-3-ethoxycarbonyl-6-methylsulfonyloxycyclohex-3-en-1-yl] benzoate.
| Compound Name | [(1R,5S,6R)-5-azido-3-ethoxycarbonyl-6-methylsulfonyloxycyclohex-3-en-1-yl] benzoate |
|---|---|
| PubChem CID | 42599437 |
| Molecular Formula | C17H19N3O7S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [(1R,5S,6R)-5-azido-3-ethoxycarbonyl-6-methylsulfonyloxycyclohex-3-en-1-yl] benzoate |
| SMILES | CCOC(=O)C1=C[C@H](N=[N+]=[N-])[C@@H](OS(C)(=O)=O)[C@H](OC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H19N3O7S/c1-3-25-16(21)12-9-13(19-20-18)15(27-28(2,23)24)14(10-12)26-17(22)11-7-5-4-6-8-11/h4-9,13-15H,3,10H2,1-2H3/t13-,14+,15+/m0/s1 |
| InChIKey | JUZJGVJAXCOGJR-RRFJBIMHSA-N |
| XLogP | 2.13 |
| TPSA | 144.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|