C23H33NO10S2 — CID 72650371
ethyl 3-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,5-bis(methylsulfonyloxy)cyclohexene-1-carboxylate (PubChem CID 72650371) has the molecular formula C23H33NO10S2 and a molecular weight of 547.65 g/mol. Its IUPAC name is ethyl 3-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,5-bis(methylsulfonyloxy)cyclohexene-1-carboxylate.
| Compound Name | ethyl 3-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,5-bis(methylsulfonyloxy)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 72650371 |
| Molecular Formula | C23H33NO10S2 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | ethyl 3-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,5-bis(methylsulfonyloxy)cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(N(Cc2ccccc2)C(=O)OC(C)(C)C)C(OS(C)(=O)=O)C(OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C23H33NO10S2/c1-7-31-21(25)17-13-18(20(34-36(6,29)30)19(14-17)33-35(5,27)28)24(22(26)32-23(2,3)4)15-16-11-9-8-10-12-16/h8-13,18-20H,7,14-15H2,1-6H3 |
| InChIKey | ZRMIQFYSEYAYOR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|