C18H28N2O3 — CID 67080607
tert-butyl N-benzyl-N-[(3S,4S)-4-methoxypiperidin-3-yl]carbamate (PubChem CID 67080607) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(3S,4S)-4-methoxypiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(3S,4S)-4-methoxypiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67080607 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl N-benzyl-N-[(3S,4S)-4-methoxypiperidin-3-yl]carbamate |
| SMILES | CO[C@H]1CCNC[C@@H]1N(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O3/c1-18(2,3)23-17(21)20(13-14-8-6-5-7-9-14)15-12-19-11-10-16(15)22-4/h5-9,15-16,19H,10-13H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | AFADPKWTVZEDRM-HOTGVXAUSA-N |
| XLogP | 2.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |