C11H22N2O3 — CID 67045457
tert-butyl-[(3R,4R)-4-methoxypiperidin-3-yl]carbamic acid (PubChem CID 67045457) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is tert-butyl-[(3R,4R)-4-methoxypiperidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3R,4R)-4-methoxypiperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 67045457 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | tert-butyl-[(3R,4R)-4-methoxypiperidin-3-yl]carbamic acid |
| SMILES | CO[C@@H]1CCNC[C@H]1N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)13(10(14)15)8-7-12-6-5-9(8)16-4/h8-9,12H,5-7H2,1-4H3,(H,14,15)/t8-,9-/m1/s1 |
| InChIKey | LHHAEQDVAGMUAM-RKDXNWHRSA-N |
| XLogP | 1.14 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |