C16H31N3O4 — CID 160959788
tert-butyl(piperidin-4-yl)carbamic acid;piperidine-1-carboxylic acid (PubChem CID 160959788) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl(piperidin-4-yl)carbamic acid;piperidine-1-carboxylic acid.
| Compound Name | tert-butyl(piperidin-4-yl)carbamic acid;piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 160959788 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | tert-butyl(piperidin-4-yl)carbamic acid;piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCNCC1.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C10H20N2O2.C6H11NO2/c1-10(2,3)12(9(13)14)8-4-6-11-7-5-8;8-6(9)7-4-2-1-3-5-7/h8,11H,4-7H2,1-3H3,(H,13,14);1-5H2,(H,8,9) |
| InChIKey | SWWDEWLLPBLROI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |