About iodomethane;piperidine-1-carboxylic acid
iodomethane;piperidine-1-carboxylic acid (PubChem CID 159672368) has the molecular formula C7H14INO2
and a molecular weight of 271.10 g/mol. Its IUPAC name is iodomethane;piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | iodomethane;piperidine-1-carboxylic acid |
| PubChem CID | 159672368 |
| Molecular Formula | C7H14INO2 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | iodomethane;piperidine-1-carboxylic acid |
| SMILES | CI.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C6H11NO2.CH3I/c8-6(9)7-4-2-1-3-5-7;1-2/h1-5H2,(H,8,9);1H3 |
| InChIKey | MUDUPNYLXWZURD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethane;piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethane;piperidine-1-carboxylic acid?
The IUPAC name of iodomethane;piperidine-1-carboxylic acid (CID 159672368) is iodomethane;piperidine-1-carboxylic acid.
What is the SMILES notation for iodomethane;piperidine-1-carboxylic acid?
The canonical SMILES for iodomethane;piperidine-1-carboxylic acid is CI.O=C(O)N1CCCCC1.
What is the InChIKey of iodomethane;piperidine-1-carboxylic acid?
The InChIKey is MUDUPNYLXWZURD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.CH3I/c8-6(9)7-4-2-1-3-5-7;1-2/h1-5H2,(H,8,9);1H3.
What are the key properties of iodomethane;piperidine-1-carboxylic acid?
iodomethane;piperidine-1-carboxylic acid has a molecular weight of 271.10 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethane;piperidine-1-carboxylic acid is sourced from PubChem (CID 159672368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).