2,2-dimethoxyethanamine;piperidine-1-carboxylic acid

C10H22N2O4 — CID 69464165

IUPAC2,2-dimethoxyethanamine;piperidine-1-carboxylic acid
SMILESCOC(CN)OC.O=C(O)N1CCCCC1
InChIInChI=1S/C6H11NO2.C4H11NO2/c8-6(9)7-4-2-1-3-5-7;1-6-4(3-5)7-2/h1-5H2,(H,8,9);4H,3,5H2,1-2H3
InChIKeyQEKAHQFSRSTAAI-UHFFFAOYSA-N
MW234.30 g/mol
LogP0.71
Rot. Bonds3

About 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid

2,2-dimethoxyethanamine;piperidine-1-carboxylic acid (PubChem CID 69464165) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid.

Molecular Properties

Compound Name2,2-dimethoxyethanamine;piperidine-1-carboxylic acid
PubChem CID69464165
Molecular FormulaC10H22N2O4
Molecular Weight234.30 g/mol
Exact Mass234.16
IUPAC Name2,2-dimethoxyethanamine;piperidine-1-carboxylic acid
SMILESCOC(CN)OC.O=C(O)N1CCCCC1
InChIInChI=1S/C6H11NO2.C4H11NO2/c8-6(9)7-4-2-1-3-5-7;1-6-4(3-5)7-2/h1-5H2,(H,8,9);4H,3,5H2,1-2H3
InChIKeyQEKAHQFSRSTAAI-UHFFFAOYSA-N
XLogP0.71
TPSA85.02 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.30
LogP ≤ 50.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid?
The IUPAC name of 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid (CID 69464165) is 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid.
What is the SMILES notation for 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid?
The canonical SMILES for 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid is COC(CN)OC.O=C(O)N1CCCCC1.
What is the InChIKey of 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid?
The InChIKey is QEKAHQFSRSTAAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C4H11NO2/c8-6(9)7-4-2-1-3-5-7;1-6-4(3-5)7-2/h1-5H2,(H,8,9);4H,3,5H2,1-2H3.
What are the key properties of 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid?
2,2-dimethoxyethanamine;piperidine-1-carboxylic acid has a molecular weight of 234.30 g/mol, XLogP of 0.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid is sourced from PubChem (CID 69464165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).