C10H22N2O4 — CID 69464165
2,2-dimethoxyethanamine;piperidine-1-carboxylic acid (PubChem CID 69464165) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid.
| Compound Name | 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69464165 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2,2-dimethoxyethanamine;piperidine-1-carboxylic acid |
| SMILES | COC(CN)OC.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C6H11NO2.C4H11NO2/c8-6(9)7-4-2-1-3-5-7;1-6-4(3-5)7-2/h1-5H2,(H,8,9);4H,3,5H2,1-2H3 |
| InChIKey | QEKAHQFSRSTAAI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|