About tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid
tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid (PubChem CID 141216999) has the molecular formula C12H20F3NO4
and a molecular weight of 299.29 g/mol. Its IUPAC name is tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid.
Analyze tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid?
The IUPAC name of tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid (CID 141216999) is tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid.
What is the SMILES notation for tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid?
The canonical SMILES for tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid is CC(C)(C)OC(=O)C(F)(F)F.O=C(O)N1CCCCC1.
What is the InChIKey of tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid?
The InChIKey is YQZIOQBJCYIXFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3O2.C6H11NO2/c1-5(2,3)11-4(10)6(7,8)9;8-6(9)7-4-2-1-3-5-7/h1-3H3;1-5H2,(H,8,9).
What are the key properties of tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid?
tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid has a molecular weight of 299.29 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,2,2-trifluoroacetate;piperidine-1-carboxylic acid is sourced from PubChem (CID 141216999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).