C20H25NO2S — CID 162418871
N,N-dibenzylcyclohexanesulfonamide (PubChem CID 162418871) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is N,N-dibenzylcyclohexanesulfonamide.
| Compound Name | N,N-dibenzylcyclohexanesulfonamide |
|---|---|
| PubChem CID | 162418871 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N,N-dibenzylcyclohexanesulfonamide |
| SMILES | O=S(=O)(C1CCCCC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H25NO2S/c22-24(23,20-14-8-3-9-15-20)21(16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19/h1-2,4-7,10-13,20H,3,8-9,14-17H2 |
| InChIKey | XMNLBVRKNYIQHQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |