C7H10FN3O5S — CID 46223400
[(1R,2R,3R,4R,5R)-4-azido-2-fluoro-6,8-dioxabicyclo[3.2.1]octan-3-yl] methanesulfonate (PubChem CID 46223400) has the molecular formula C7H10FN3O5S and a molecular weight of 267.24 g/mol. Its IUPAC name is [(1R,2R,3R,4R,5R)-4-azido-2-fluoro-6,8-dioxabicyclo[3.2.1]octan-3-yl] methanesulfonate.
| Compound Name | [(1R,2R,3R,4R,5R)-4-azido-2-fluoro-6,8-dioxabicyclo[3.2.1]octan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 46223400 |
| Molecular Formula | C7H10FN3O5S |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | [(1R,2R,3R,4R,5R)-4-azido-2-fluoro-6,8-dioxabicyclo[3.2.1]octan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1[C@H](F)[C@H]2CO[C@H](O2)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C7H10FN3O5S/c1-17(12,13)16-6-4(8)3-2-14-7(15-3)5(6)10-11-9/h3-7H,2H2,1H3/t3-,4-,5-,6+,7-/m1/s1 |
| InChIKey | NJRWEWDKLPUHGU-BNWJMWRWSA-N |
| XLogP | 0.10 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|