C13H14FN3O5S — CID 46223635
[(1S,2R,3S,4S,5R)-2-azido-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate (PubChem CID 46223635) has the molecular formula C13H14FN3O5S and a molecular weight of 343.34 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5R)-2-azido-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,3S,4S,5R)-2-azido-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46223635 |
| Molecular Formula | C13H14FN3O5S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | [(1S,2R,3S,4S,5R)-2-azido-3-fluoro-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@@H]3OC[C@@H](O3)[C@@H](N=[N+]=[N-])[C@@H]2F)cc1 |
| InChI | InChI=1S/C13H14FN3O5S/c1-7-2-4-8(5-3-7)23(18,19)22-12-10(14)11(16-17-15)9-6-20-13(12)21-9/h2-5,9-13H,6H2,1H3/t9-,10+,11-,12-,13-/m1/s1 |
| InChIKey | PCWSPLRCOCVOSP-NZEXEKPDSA-N |
| XLogP | 1.84 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|