C16H23NO6S — CID 19181334
[(1S,2R,3R,4S,5R)-3-hydroxy-2-(propan-2-ylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate (PubChem CID 19181334) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5R)-3-hydroxy-2-(propan-2-ylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,3R,4S,5R)-3-hydroxy-2-(propan-2-ylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19181334 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [(1S,2R,3R,4S,5R)-3-hydroxy-2-(propan-2-ylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@@H]3OC[C@@H](O3)[C@H](NC(C)C)[C@H]2O)cc1 |
| InChI | InChI=1S/C16H23NO6S/c1-9(2)17-13-12-8-21-16(22-12)15(14(13)18)23-24(19,20)11-6-4-10(3)5-7-11/h4-7,9,12-18H,8H2,1-3H3/t12-,13+,14-,15+,16-/m1/s1 |
| InChIKey | BMNIYWVPBNNPQM-DGADGQDISA-N |
| XLogP | 0.55 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|