C29H35NO6SSi — CID 10918684
N-[(1S,2S,3R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 10918684) has the molecular formula C29H35NO6SSi and a molecular weight of 553.75 g/mol. Its IUPAC name is N-[(1S,2S,3R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2S,3R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10918684 |
| Molecular Formula | C29H35NO6SSi |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | N-[(1S,2S,3R,4S,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2[C@@H](O)[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]3OC[C@H]2O3)cc1 |
| InChI | InChI=1S/C29H35NO6SSi/c1-20-15-17-21(18-16-20)37(32,33)30-25-24-19-34-28(35-24)27(26(25)31)36-38(29(2,3)4,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-18,24-28,30-31H,19H2,1-4H3/t24-,25-,26-,27+,28-/m1/s1 |
| InChIKey | NZDZCRXQGDNVLQ-VNFNVIIVSA-N |
| XLogP | 2.70 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|