C20H22BrNO5S — CID 10863612
N-[(1S,2R,3S,4S,5R)-3-bromo-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 10863612) has the molecular formula C20H22BrNO5S and a molecular weight of 468.37 g/mol. Its IUPAC name is N-[(1S,2R,3S,4S,5R)-3-bromo-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2R,3S,4S,5R)-3-bromo-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10863612 |
| Molecular Formula | C20H22BrNO5S |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | N-[(1S,2R,3S,4S,5R)-3-bromo-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2[C@H](Br)[C@@H](OCc3ccccc3)[C@@H]3OC[C@H]2O3)cc1 |
| InChI | InChI=1S/C20H22BrNO5S/c1-13-7-9-15(10-8-13)28(23,24)22-18-16-12-26-20(27-16)19(17(18)21)25-11-14-5-3-2-4-6-14/h2-10,16-20,22H,11-12H2,1H3/t16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | HZEMWQLBSIQEMT-USYVTKNRSA-N |
| XLogP | 2.75 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|