C19H19ClN2O7S — CID 101269685
N-[(1R,2S,3S,4R,5R)-4-chloro-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-2-nitrobenzenesulfonamide (PubChem CID 101269685) has the molecular formula C19H19ClN2O7S and a molecular weight of 454.89 g/mol. Its IUPAC name is N-[(1R,2S,3S,4R,5R)-4-chloro-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,2S,3S,4R,5R)-4-chloro-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 101269685 |
| Molecular Formula | C19H19ClN2O7S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-[(1R,2S,3S,4R,5R)-4-chloro-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N[C@@H]1[C@@H](Cl)[C@@H]2OC[C@@H](O2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H19ClN2O7S/c20-16-17(21-30(25,26)15-9-5-4-8-13(15)22(23)24)18(14-11-28-19(16)29-14)27-10-12-6-2-1-3-7-12/h1-9,14,16-19,21H,10-11H2/t14-,16-,17-,18-,19-/m1/s1 |
| InChIKey | GBUQPBKIGPYMNR-WSIUPNEHSA-N |
| XLogP | 2.19 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|