C17H16N2O6S — CID 139065129
N-[(3S,4S)-4-benzyl-5-oxooxolan-3-yl]-2-nitrobenzenesulfonamide (PubChem CID 139065129) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is N-[(3S,4S)-4-benzyl-5-oxooxolan-3-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(3S,4S)-4-benzyl-5-oxooxolan-3-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 139065129 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-[(3S,4S)-4-benzyl-5-oxooxolan-3-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=C1OC[C@@H](NS(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2O6S/c20-17-13(10-12-6-2-1-3-7-12)14(11-25-17)18-26(23,24)16-9-5-4-8-15(16)19(21)22/h1-9,13-14,18H,10-11H2/t13-,14+/m0/s1 |
| InChIKey | QDIWPYFLYJNAJW-UONOGXRCSA-N |
| XLogP | 1.66 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|