C12H15N3O4S — CID 178194812
N-[(1S,4R,6S)-2-azabicyclo[2.2.1]heptan-6-yl]-2-nitrobenzenesulfonamide (PubChem CID 178194812) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[(1S,4R,6S)-2-azabicyclo[2.2.1]heptan-6-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(1S,4R,6S)-2-azabicyclo[2.2.1]heptan-6-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 178194812 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[(1S,4R,6S)-2-azabicyclo[2.2.1]heptan-6-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N[C@H]1C[C@@H]2CN[C@H]1C2 |
| InChI | InChI=1S/C12H15N3O4S/c16-15(17)11-3-1-2-4-12(11)20(18,19)14-10-6-8-5-9(10)13-7-8/h1-4,8-10,13-14H,5-7H2/t8-,9+,10+/m1/s1 |
| InChIKey | DFVPQPOYKRHTNI-UTLUCORTSA-N |
| XLogP | 0.62 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|