C16H22N2O4S — CID 99851529
2-nitro-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide (PubChem CID 99851529) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-nitro-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 99851529 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-nitro-N-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C16H22N2O4S/c1-15(2)11-8-9-16(15,3)14(10-11)17-23(21,22)13-7-5-4-6-12(13)18(19)20/h4-7,11,14,17H,8-10H2,1-3H3/t11-,14+,16-/m1/s1 |
| InChIKey | ZWOUAHBUIGPPCJ-DIOULYMOSA-N |
| XLogP | 3.09 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|