C22H28N4O8S2 — CID 98287734
2-nitro-N-[[(1R,5S)-1,3,3-trimethyl-5-[(2-nitrophenyl)sulfonylamino]cyclohexyl]methyl]benzenesulfonamide (PubChem CID 98287734) has the molecular formula C22H28N4O8S2 and a molecular weight of 540.62 g/mol. Its IUPAC name is 2-nitro-N-[[(1R,5S)-1,3,3-trimethyl-5-[(2-nitrophenyl)sulfonylamino]cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[[(1R,5S)-1,3,3-trimethyl-5-[(2-nitrophenyl)sulfonylamino]cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 98287734 |
| Molecular Formula | C22H28N4O8S2 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2-nitro-N-[[(1R,5S)-1,3,3-trimethyl-5-[(2-nitrophenyl)sulfonylamino]cyclohexyl]methyl]benzenesulfonamide |
| SMILES | CC1(C)C[C@H](NS(=O)(=O)c2ccccc2[N+](=O)[O-])C[C@](C)(CNS(=O)(=O)c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H28N4O8S2/c1-21(2)12-16(24-36(33,34)20-11-7-5-9-18(20)26(29)30)13-22(3,14-21)15-23-35(31,32)19-10-6-4-8-17(19)25(27)28/h4-11,16,23-24H,12-15H2,1-3H3/t16-,22-/m0/s1 |
| InChIKey | LWJUFVNILVPQPC-AOMKIAJQSA-N |
| XLogP | 3.34 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|