C29H39N3O8S — CID 177390734
tert-butyl (2S)-4-methyl-2-[(3R,4R,5R)-3-methyl-4-[(2-nitrophenyl)sulfonylamino]-2-oxo-5-phenylmethoxypiperidin-1-yl]pentanoate (PubChem CID 177390734) has the molecular formula C29H39N3O8S and a molecular weight of 589.71 g/mol. Its IUPAC name is tert-butyl (2S)-4-methyl-2-[(3R,4R,5R)-3-methyl-4-[(2-nitrophenyl)sulfonylamino]-2-oxo-5-phenylmethoxypiperidin-1-yl]pentanoate.
| Compound Name | tert-butyl (2S)-4-methyl-2-[(3R,4R,5R)-3-methyl-4-[(2-nitrophenyl)sulfonylamino]-2-oxo-5-phenylmethoxypiperidin-1-yl]pentanoate |
|---|---|
| PubChem CID | 177390734 |
| Molecular Formula | C29H39N3O8S |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | tert-butyl (2S)-4-methyl-2-[(3R,4R,5R)-3-methyl-4-[(2-nitrophenyl)sulfonylamino]-2-oxo-5-phenylmethoxypiperidin-1-yl]pentanoate |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)(C)C)N1C[C@@H](OCc2ccccc2)[C@H](NS(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](C)C1=O |
| InChI | InChI=1S/C29H39N3O8S/c1-19(2)16-23(28(34)40-29(4,5)6)31-17-24(39-18-21-12-8-7-9-13-21)26(20(3)27(31)33)30-41(37,38)25-15-11-10-14-22(25)32(35)36/h7-15,19-20,23-24,26,30H,16-18H2,1-6H3/t20-,23+,24-,26-/m1/s1 |
| InChIKey | IRCIDUIROJTDAA-JOXZGHKQSA-N |
| XLogP | 4.06 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|