C20H29N3O7S — CID 138685549
4-methyl-2-[(3S)-3-(2-methylpropyl)-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]pentanoic acid (PubChem CID 138685549) has the molecular formula C20H29N3O7S and a molecular weight of 455.53 g/mol. Its IUPAC name is 4-methyl-2-[(3S)-3-(2-methylpropyl)-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]pentanoic acid.
| Compound Name | 4-methyl-2-[(3S)-3-(2-methylpropyl)-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 138685549 |
| Molecular Formula | C20H29N3O7S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-methyl-2-[(3S)-3-(2-methylpropyl)-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]pentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C20H29N3O7S/c1-13(2)11-16-19(24)21(17(20(25)26)12-14(3)4)9-10-22(16)31(29,30)18-8-6-5-7-15(18)23(27)28/h5-8,13-14,16-17H,9-12H2,1-4H3,(H,25,26)/t16-,17?/m0/s1 |
| InChIKey | KCRAOJLIHZIYIL-BHWOMJMDSA-N |
| XLogP | 2.34 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|