C15H19N3O7S — CID 175172729
2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]butanoic acid (PubChem CID 175172729) has the molecular formula C15H19N3O7S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]butanoic acid.
| Compound Name | 2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 175172729 |
| Molecular Formula | C15H19N3O7S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](C)C1=O |
| InChI | InChI=1S/C15H19N3O7S/c1-3-11(15(20)21)16-8-9-17(10(2)14(16)19)26(24,25)13-7-5-4-6-12(13)18(22)23/h4-7,10-11H,3,8-9H2,1-2H3,(H,20,21)/t10-,11?/m0/s1 |
| InChIKey | QLSPECSEUGTHHG-VUWPPUDQSA-N |
| XLogP | 0.68 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|