C20H30N4O8S — CID 2902712
1-(2-nitrophenyl)sulfonyl-4-(1-propylpiperidin-4-yl)piperazine;oxalic acid (PubChem CID 2902712) has the molecular formula C20H30N4O8S and a molecular weight of 486.55 g/mol. Its IUPAC name is 1-(2-nitrophenyl)sulfonyl-4-(1-propylpiperidin-4-yl)piperazine;oxalic acid.
| Compound Name | 1-(2-nitrophenyl)sulfonyl-4-(1-propylpiperidin-4-yl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 2902712 |
| Molecular Formula | C20H30N4O8S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-(2-nitrophenyl)sulfonyl-4-(1-propylpiperidin-4-yl)piperazine;oxalic acid |
| SMILES | CCCN1CCC(N2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H28N4O4S.C2H2O4/c1-2-9-19-10-7-16(8-11-19)20-12-14-21(15-13-20)27(25,26)18-6-4-3-5-17(18)22(23)24;3-1(4)2(5)6/h3-6,16H,2,7-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | LDKOUWUXTSSPHZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|