C21H33N3O7S — CID 90483664
1-(4-methoxyphenyl)sulfonyl-4-(1-propylpiperidin-4-yl)piperazine;oxalic acid (PubChem CID 90483664) has the molecular formula C21H33N3O7S and a molecular weight of 471.58 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-4-(1-propylpiperidin-4-yl)piperazine;oxalic acid.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-4-(1-propylpiperidin-4-yl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 90483664 |
| Molecular Formula | C21H33N3O7S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-4-(1-propylpiperidin-4-yl)piperazine;oxalic acid |
| SMILES | CCCN1CCC(N2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H31N3O3S.C2H2O4/c1-3-10-20-11-8-17(9-12-20)21-13-15-22(16-14-21)26(23,24)19-6-4-18(25-2)5-7-19;3-1(4)2(5)6/h4-7,17H,3,8-16H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | AZFQESDMEUOBLN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|