C18H24N4O4S — CID 2376038
1-[2-(2,5-dimethylpyrrol-1-yl)ethyl]-4-(2-nitrophenyl)sulfonylpiperazine (PubChem CID 2376038) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylpyrrol-1-yl)ethyl]-4-(2-nitrophenyl)sulfonylpiperazine.
| Compound Name | 1-[2-(2,5-dimethylpyrrol-1-yl)ethyl]-4-(2-nitrophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 2376038 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[2-(2,5-dimethylpyrrol-1-yl)ethyl]-4-(2-nitrophenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(C)n1CCN1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H24N4O4S/c1-15-7-8-16(2)21(15)14-11-19-9-12-20(13-10-19)27(25,26)18-6-4-3-5-17(18)22(23)24/h3-8H,9-14H2,1-2H3 |
| InChIKey | FOETXKGBYKTCRA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|