C16H21N5O6S — CID 55860399
3-[3-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propyl]imidazolidine-2,4-dione (PubChem CID 55860399) has the molecular formula C16H21N5O6S and a molecular weight of 411.44 g/mol. Its IUPAC name is 3-[3-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55860399 |
| Molecular Formula | C16H21N5O6S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-[3-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCN1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H21N5O6S/c22-15-12-17-16(23)20(15)7-3-6-18-8-10-19(11-9-18)28(26,27)14-5-2-1-4-13(14)21(24)25/h1-2,4-5H,3,6-12H2,(H,17,23) |
| InChIKey | MCOGAHRSXGEEPH-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|