C12H17N3O4S — CID 121014557
1-(2-nitrophenyl)sulfonyl-1,5-diazocane (PubChem CID 121014557) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-(2-nitrophenyl)sulfonyl-1,5-diazocane.
| Compound Name | 1-(2-nitrophenyl)sulfonyl-1,5-diazocane |
|---|---|
| PubChem CID | 121014557 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-(2-nitrophenyl)sulfonyl-1,5-diazocane |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCCNCCC1 |
| InChI | InChI=1S/C12H17N3O4S/c16-15(17)11-5-1-2-6-12(11)20(18,19)14-9-3-7-13-8-4-10-14/h1-2,5-6,13H,3-4,7-10H2 |
| InChIKey | FXBHSAVKOYXDNR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|