C42H38N8O16S4 — CID 101172308
3,6,9,12-tetrakis[(2-nitrophenyl)sulfonyl]-3,6,9,12-tetrazatricyclo[12.6.2.015,20]docosa-1(21),14(22),15,17,19-pentaene (PubChem CID 101172308) has the molecular formula C42H38N8O16S4 and a molecular weight of 1039.07 g/mol. Its IUPAC name is 3,6,9,12-tetrakis[(2-nitrophenyl)sulfonyl]-3,6,9,12-tetrazatricyclo[12.6.2.015,20]docosa-1(21),14(22),15,17,19-pentaene.
| Compound Name | 3,6,9,12-tetrakis[(2-nitrophenyl)sulfonyl]-3,6,9,12-tetrazatricyclo[12.6.2.015,20]docosa-1(21),14(22),15,17,19-pentaene |
|---|---|
| PubChem CID | 101172308 |
| Molecular Formula | C42H38N8O16S4 |
| Molecular Weight | 1039.07 g/mol |
| Exact Mass | 1038.13 |
| IUPAC Name | 3,6,9,12-tetrakis[(2-nitrophenyl)sulfonyl]-3,6,9,12-tetrazatricyclo[12.6.2.015,20]docosa-1(21),14(22),15,17,19-pentaene |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2ccc(c3ccccc23)CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C42H38N8O16S4/c51-47(52)35-13-3-7-17-39(35)67(59,60)43-23-24-44(68(61,62)40-18-8-4-14-36(40)48(53)54)26-28-46(70(65,66)42-20-10-6-16-38(42)50(57)58)30-32-22-21-31(33-11-1-2-12-34(32)33)29-45(27-25-43)69(63,64)41-19-9-5-15-37(41)49(55)56/h1-22H,23-30H2 |
| InChIKey | GWAXOHIVFQJELC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 322.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.07 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|