C28H37N3O7S — CID 126559762
tert-butyl (2S)-3-(4-tert-butylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]propanoate (PubChem CID 126559762) has the molecular formula C28H37N3O7S and a molecular weight of 559.69 g/mol. Its IUPAC name is tert-butyl (2S)-3-(4-tert-butylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]propanoate.
| Compound Name | tert-butyl (2S)-3-(4-tert-butylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 126559762 |
| Molecular Formula | C28H37N3O7S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | tert-butyl (2S)-3-(4-tert-butylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]propanoate |
| SMILES | C[C@H]1C(=O)N([C@@H](Cc2ccc(C(C)(C)C)cc2)C(=O)OC(C)(C)C)CCN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H37N3O7S/c1-19-25(32)29(16-17-30(19)39(36,37)24-11-9-8-10-22(24)31(34)35)23(26(33)38-28(5,6)7)18-20-12-14-21(15-13-20)27(2,3)4/h8-15,19,23H,16-18H2,1-7H3/t19-,23-/m0/s1 |
| InChIKey | JCBMAYMUEFPFOI-CVDCTZTESA-N |
| XLogP | 4.07 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|