C22H24F3N3O5S — CID 126559217
(3S)-3-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4-[4-(trifluoromethyl)phenyl]butan-2-one (PubChem CID 126559217) has the molecular formula C22H24F3N3O5S and a molecular weight of 499.51 g/mol. Its IUPAC name is (3S)-3-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4-[4-(trifluoromethyl)phenyl]butan-2-one.
| Compound Name | (3S)-3-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4-[4-(trifluoromethyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 126559217 |
| Molecular Formula | C22H24F3N3O5S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (3S)-3-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4-[4-(trifluoromethyl)phenyl]butan-2-one |
| SMILES | CC(=O)[C@H](Cc1ccc(C(F)(F)F)cc1)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](C)C1 |
| InChI | InChI=1S/C22H24F3N3O5S/c1-15-14-26(20(16(2)29)13-17-7-9-18(10-8-17)22(23,24)25)11-12-27(15)34(32,33)21-6-4-3-5-19(21)28(30)31/h3-10,15,20H,11-14H2,1-2H3/t15-,20-/m0/s1 |
| InChIKey | DMWLNJLMHYAHJE-YWZLYKJASA-N |
| XLogP | 3.51 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|