C30H39N3O6S — CID 138660170
tert-butyl (2S)-2-[(3S)-3-(cyclopropylmethyl)-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-(2,3-dihydro-1H-inden-5-yl)propanoate (PubChem CID 138660170) has the molecular formula C30H39N3O6S and a molecular weight of 569.72 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3S)-3-(cyclopropylmethyl)-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-(2,3-dihydro-1H-inden-5-yl)propanoate.
| Compound Name | tert-butyl (2S)-2-[(3S)-3-(cyclopropylmethyl)-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-(2,3-dihydro-1H-inden-5-yl)propanoate |
|---|---|
| PubChem CID | 138660170 |
| Molecular Formula | C30H39N3O6S |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | tert-butyl (2S)-2-[(3S)-3-(cyclopropylmethyl)-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-(2,3-dihydro-1H-inden-5-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc2c(c1)CCC2)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](CC2CC2)C1 |
| InChI | InChI=1S/C30H39N3O6S/c1-30(2,3)39-29(34)27(19-22-13-14-23-7-6-8-24(23)17-22)31-15-16-32(25(20-31)18-21-11-12-21)40(37,38)28-10-5-4-9-26(28)33(35)36/h4-5,9-10,13-14,17,21,25,27H,6-8,11-12,15-16,18-20H2,1-3H3/t25-,27-/m0/s1 |
| InChIKey | XKGXIUOWQUXLKE-BDYUSTAISA-N |
| XLogP | 4.51 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|