C28H33N3O9S — CID 138659899
tert-butyl (2S)-3-(2,3-dihydro-1H-inden-5-yl)-2-[(3S)-3-(methoxymethyl)-4-(2-nitrophenyl)sulfonyl-2,6-dioxopiperazin-1-yl]propanoate (PubChem CID 138659899) has the molecular formula C28H33N3O9S and a molecular weight of 587.65 g/mol. Its IUPAC name is tert-butyl (2S)-3-(2,3-dihydro-1H-inden-5-yl)-2-[(3S)-3-(methoxymethyl)-4-(2-nitrophenyl)sulfonyl-2,6-dioxopiperazin-1-yl]propanoate.
| Compound Name | tert-butyl (2S)-3-(2,3-dihydro-1H-inden-5-yl)-2-[(3S)-3-(methoxymethyl)-4-(2-nitrophenyl)sulfonyl-2,6-dioxopiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 138659899 |
| Molecular Formula | C28H33N3O9S |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | tert-butyl (2S)-3-(2,3-dihydro-1H-inden-5-yl)-2-[(3S)-3-(methoxymethyl)-4-(2-nitrophenyl)sulfonyl-2,6-dioxopiperazin-1-yl]propanoate |
| SMILES | COC[C@H]1C(=O)N([C@@H](Cc2ccc3c(c2)CCC3)C(=O)OC(C)(C)C)C(=O)CN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H33N3O9S/c1-28(2,3)40-27(34)22(15-18-12-13-19-8-7-9-20(19)14-18)30-25(32)16-29(23(17-39-4)26(30)33)41(37,38)24-11-6-5-10-21(24)31(35)36/h5-6,10-14,22-23H,7-9,15-17H2,1-4H3/t22-,23-/m0/s1 |
| InChIKey | CVIAUOXQAXUCMW-GOTSBHOMSA-N |
| XLogP | 2.41 |
| TPSA | 153.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|