C18H20N2O4S — CID 28533880
2-nitro-N-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzenesulfonamide (PubChem CID 28533880) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-nitro-N-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 28533880 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-nitro-N-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H20N2O4S/c1-13(15-11-10-14-6-2-3-7-16(14)12-15)19-25(23,24)18-9-5-4-8-17(18)20(21)22/h4-5,8-13,19H,2-3,6-7H2,1H3/t13-/m1/s1 |
| InChIKey | UFNJQZRCYFWIMX-CYBMUJFWSA-N |
| XLogP | 3.51 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|