C18H21NO2S — CID 42913053
N-(1-phenylethyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 42913053) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-(1-phenylethyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-(1-phenylethyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 42913053 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-(1-phenylethyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc2c(c1)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2S/c1-14(15-7-3-2-4-8-15)19-22(20,21)18-12-11-16-9-5-6-10-17(16)13-18/h2-4,7-8,11-14,19H,5-6,9-10H2,1H3 |
| InChIKey | KZBYKFUAPZQZEF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |