C21H21NO2S — CID 133188833
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]naphthalene-2-sulfonamide (PubChem CID 133188833) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 133188833 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]naphthalene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc2ccccc2c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C21H21NO2S/c1-15(18-10-9-17-7-4-8-19(17)13-18)22-25(23,24)21-12-11-16-5-2-3-6-20(16)14-21/h2-3,5-6,9-15,22H,4,7-8H2,1H3 |
| InChIKey | QHYQVZJUBTUYOU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |